On Target ACE2_HUMAN 0.20873787/CHEMBL254493
For the given ligand Inophinone, we have found in our database that, being scored 0.20873787, the most similar ligand is CHEMBL254493. Check out the elaboration below.
| Inophinone (Given Ligand) | CHEMBL254493 (Similar Ligand) |
|---|---|
| C/C(C)=C/Cc4c1OC(C)(C)/C=C\c1c(O)c5c(=O)c3c2OC(C)(C)/C=C\c2c(O)cc3oc45 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccccc1OCc1ccccc1)C(=O)O |
|
|
|
|
|
|
| 04000041 00200028 280a0308 04010202 00201201 80800120 c2000081 40000600 060c4004 40980840 48000020 40008000 46808422 00200088 01000003 10082008 00000420 02108040 1800001c 00820800 00040000 0a010008 0020d000 00580010 09201200 c0004401 00522099 4a900400 10416300 81a20802 04000000 00000410 | 04010000 01005008 20100108 00110600 00001080 80004000 86000000 20000204 00000980 020a08c0 08300000 4001b0c0 06808002 00050000 81080001 02082008 90000000 02008000 00400008 00020201 00000100 18200e20 03000140 85d01418 00004800 c0002000 00000000 10000040 04000300 00070003 60004000 03012600 |