On Target RT_HIV1 0.2631579/CHEMBL4228598
For the given ligand Phylattrin, we have found in our database that, being scored 0.2631579, the most similar ligand is CHEMBL4228598. Check out the elaboration below.
| Phylattrin (Given Ligand) | CHEMBL4228598 (Similar Ligand) |
|---|---|
| COc3cc2[oH+]c1c(O)cc(C/C=C(C)\C)c(OC)c1c(=O)c2c(C)c3C/C=C(C)/C | C=C(C)[C@@H]1CC[C@]2(CNCCCN)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000001 42000c08 20000109 00018202 00001001 00828000 42040401 01000600 80040004 00980a40 08000000 40008a00 0000c022 00200000 01000001 2808a008 00000000 02100004 00082000 00020a00 00400000 08020300 0000c028 06420014 00200000 e8000000 005a0800 40a00000 02000380 00020002 87020400 02000400 | 00000000 01000c00 00100302 40050600 00000000 00004000 80000080 20000402 00000900 001809c0 08300000 40018800 00028002 00200000 00000402 00080008 00000400 02000020 02012000 00000201 01000100 18020a30 00008020 00500014 01200000 80000000 00406000 d0000000 00400002 01060012 e4020000 00002600 |