On Target NS5B_HCV1A 0.31976745/CHEMBL446360
For the given ligand Soulattrin, we have found in our database that, being scored 0.31976745, the most similar ligand is CHEMBL446360. Check out the elaboration below.
| Soulattrin (Given Ligand) | CHEMBL446360 (Similar Ligand) |
|---|---|
| C=CC(C)(C)c3c(O)ccc4c(=O)c2c(O)c1/C=C\C(C)(C)Oc1c(O)c2[oH+]c34 | N#Cc1ccc(Br)cc1Oc1ccccc1C(=O)CC(=O)C(=O)O |
|
|
|
|
|
|
| 04000001 42000828 20000309 00218200 00201001 00820000 c2240081 01000600 04040004 00180a40 48040000 40108a00 0680c022 00000000 01000003 2808a008 00000400 02108004 1000201c 00020a00 00440000 08020300 00008021 06420014 01201000 e8000000 005a2808 40a00400 00454380 80220102 87020400 00000410 | 00054004 01008808 2000010a 00018200 00081020 00020002 06404000 00000201 04000904 00880840 0814000a 4000d040 04008012 00200000 01000001 00082008 00400000 02000000 00c02008 00020001 00400100 08020a00 01000400 00400414 00000800 c0000000 00120800 00200000 00000302 00064422 81020408 08400400 |