On Target NA_A-H3N8 0.2/CHEMBL4282553
For the given ligand Inophinnin, we have found in our database that, being scored 0.2, the most similar ligand is CHEMBL4282553. Check out the elaboration below.
| Inophinnin (Given Ligand) | CHEMBL4282553 (Similar Ligand) |
|---|---|
| COc3c(C/C=C(C)\C)cc(O)c4[oH+]c2c1O[C@@H](C)C(C)(C)c1cc(O)c2c(=O)c34 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(Oc3ccccc3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 04001001 42000c08 20000108 40218202 00001041 c2820000 42040001 01000640 00140904 00980a40 08100000 40008a40 0080c022 20000080 01044001 2a08a018 08000000 02108004 04082000 00020a01 00400100 08020300 01008020 06420014 00200000 e8000000 005a0800 40a00000 00000380 0002000a 87020400 02000440 | 00070040 09007008 20100108 84010700 00181080 00000800 020c0180 3a00140a 11000000 001108c8 40200000 41019001 0402881a 01882000 01001409 00081008 10a04000 02000060 60c12010 00020201 00400020 38048e80 13008080 02500018 10001401 c0001400 00e24000 90200001 0c000300 00060401 24060400 00800a10 |