On Target NP_HCoV-OC43 0.07692308/CHEMBL3233481
For the given ligand Phylattrin, we have found in our database that, being scored 0.07692308, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Phylattrin (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| COc3cc2[oH+]c1c(O)cc(C/C=C(C)\C)c(OC)c1c(=O)c2c(C)c3C/C=C(C)/C | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000001 42000c08 20000109 00018202 00001001 00828000 42040401 01000600 80040004 00980a40 08000000 40008a00 0000c022 00200000 01000001 2808a008 00000000 02100004 00082000 00020a00 00400000 08020300 0000c028 06420014 00200000 e8000000 005a0800 40a00000 02000380 00020002 87020400 02000400 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |