On Target PLP_SARS 0.23595506/CHEMBL222735
For the given ligand Inophinnin, we have found in our database that, being scored 0.23595506, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| Inophinnin (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| COc3c(C/C=C(C)\C)cc(O)c4[oH+]c2c1O[C@@H](C)C(C)(C)c1cc(O)c2c(=O)c34 | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 04001001 42000c08 20000108 40218202 00001041 c2820000 42040001 01000640 00140904 00980a40 08100000 40008a40 0080c022 20000080 01044001 2a08a018 08000000 02108004 04082000 00020a01 00400100 08020300 01008020 06420014 00200000 e8000000 005a0800 40a00000 00000380 0002000a 87020400 02000440 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |