On Target NS3_HCV1A 0.38655463/CHEMBL4107639
For the given ligand DB00800, we have found in our database that, being scored 0.38655463, the most similar ligand is CHEMBL4107639. Check out the elaboration below.
| DB00800 (Given Ligand) | CHEMBL4107639 (Similar Ligand) |
|---|---|
| Oc3ccc([C@H]2CNCCc1c(Cl)c(O)c(O)cc12)cc3 | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2cccc(O)c2)c1F |
|
|
|
|
|
|
| 00008000 46000008 20110100 00010600 00000020 80000000 16000400 01000001 00000080 00080844 08200000 40808900 02000006 00200002 80000000 00008008 00000200 02100000 00100000 00020200 00000400 18200100 00004000 814a0010 00002000 a0000a00 00120000 40000000 06000080 00060002 00000000 00022600 | 00008040 42000808 20100100 02010600 00000201 00000010 22000000 01001000 00000800 00080e40 08100000 40008a00 02008866 00001004 00000000 28080008 03000200 03000000 00000400 00020201 00000500 18028300 01000000 10420014 00002000 a0000200 08040000 40800081 00000080 00068002 84040000 00020600 |