Created at: Last updated at: Current status:
|
Name | DB00800 |
2D and 3D depictions | |
SMILES | Oc3ccc([C@H]2CNCCc1c(Cl)c(O)c(O)cc12)cc3 |
Model downloads | |
Fingerprints |
Name | DB00558 |
2D and 3D depictions | |
SMILES | CC(=O)N[C@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@@H]1[C@H](O)[C@@H](O)CO |
Model downloads | |
Fingerprints |
Name | DB01061 |
2D and 3D depictions | |
SMILES | CC4(C)S[C@@H]3[C@@H](NC(=O)[C@H](NC(=O)N1CCNC1=O)c2ccccc2)C(=O)N3[C@@H]4C(=O)O |
Model downloads | |
Fingerprints |
Name | DB00947 |
2D and 3D depictions | |
SMILES | C[C@@]14CCC[C@@H]1[C@H]3[C@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)Cc2cc(O)ccc2[C@H]3CC4 |
Model downloads | |
Fingerprints |
Name | DB00279 |
2D and 3D depictions | |
SMILES | N[C@H](Cc2cc(I)c(Oc1ccc(O)c(I)c1)c(I)c2)C(=O)O |
Model downloads | |
Fingerprints |