On Target NS3_HCV1A 0.24264705/CHEMBL4107639
For the given ligand DB00947, we have found in our database that, being scored 0.24264705, the most similar ligand is CHEMBL4107639. Check out the elaboration below.
| DB00947 (Given Ligand) | CHEMBL4107639 (Similar Ligand) |
|---|---|
| C[C@@]14CCC[C@@H]1[C@H]3[C@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)Cc2cc(O)ccc2[C@H]3CC4 | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2cccc(O)c2)c1F |
|
|
|
|
|
|
| 00000000 47000008 20100102 00110200 00000000 40000082 02000000 00000001 05200800 00084840 08100000 40128000 00010002 00240000 80000020 00000008 04000200 02000000 02002000 00020201 40000100 08000001 00004300 00f40010 00000000 80020001 00120020 90000000 0000000a 03020022 00020000 01010620 | 00008040 42000808 20100100 02010600 00000201 00000010 22000000 01001000 00000800 00080e40 08100000 40008a00 02008866 00001004 00000000 28080008 03000200 03000000 00000400 00020201 00000500 18028300 01000000 10420014 00002000 a0000200 08040000 40800081 00000080 00068002 84040000 00020600 |