On Target NS3_HCV1A 0.36407766/CHEMBL3645675
For the given ligand DB01061, we have found in our database that, being scored 0.36407766, the most similar ligand is CHEMBL3645675. Check out the elaboration below.
| DB01061 (Given Ligand) | CHEMBL3645675 (Similar Ligand) |
|---|---|
| CC4(C)S[C@@H]3[C@@H](NC(=O)[C@H](NC(=O)N1CCNC1=O)c2ccccc2)C(=O)N3[C@@H]4C(=O)O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1CC)c1ccccc1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00010000 47807000 20164360 0c310e40 00000080 00000000 00201204 02003008 00000080 0a0e4840 0b200003 4004b000 0f01e806 000c2101 c0180001 00480008 14004410 02002200 00400050 00400309 c0020100 38238e00 03000703 87400018 00001200 80000020 00004000 80000000 0c001100 00060023 20046011 83012680 | 000100a0 09803000 06100100 05210600 00000000 00000010 000a0000 22001408 10000080 0019c9c8 08602000 4001b000 0701881a 01002011 e0400400 00000000 04004000 02000000 44012000 00004201 80000000 38248630 00000003 b3d00038 00000000 c0000000 00000000 90000010 0c000100 c0060083 64066004 00012660 |