On Target ACE2_HUMAN 0.5258621/CHEMBL254282
For the given ligand DB00279, we have found in our database that, being scored 0.5258621, the most similar ligand is CHEMBL254282. Check out the elaboration below.
| DB00279 (Given Ligand) | CHEMBL254282 (Similar Ligand) |
|---|---|
| N[C@H](Cc2cc(I)c(Oc1ccc(O)c(I)c1)c(I)c2)C(=O)O | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccc(Oc2ccccc2)cc1)C(=O)O |
|
|
|
|
|
|
| 00001000 46000008 a0300108 00010600 00001000 00000008 02040000 00000040 00000800 00080840 08100000 4800b000 04008042 02002000 01080001 00080058 00000000 02000000 00402108 00020001 00410140 18002a00 03000040 81400010 00000800 80000000 001a0000 00200000 04000200 00060002 00200400 02000400 | 00010000 01005008 20100108 00110600 00001080 00000000 82040000 20000004 00000880 020a08c0 08300000 4001b000 06008002 00040000 81080001 00080008 10000000 02000000 00402008 00020201 00400100 18200e00 03000140 85500018 00000800 80000000 00120000 10200040 04000200 00060003 20004400 03012600 |