On Target NS3_HCV1B 0.19753087/CHEMBL1170410
For the given ligand DB00947, we have found in our database that, being scored 0.19753087, the most similar ligand is CHEMBL1170410. Check out the elaboration below.
| DB00947 (Given Ligand) | CHEMBL1170410 (Similar Ligand) |
|---|---|
| C[C@@]14CCC[C@@H]1[C@H]3[C@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)Cc2cc(O)ccc2[C@H]3CC4 | C=CCCCCS(=O)(=O)NC(=O)[C@H](CCC)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)c1ccc(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)c(C=C)c1 |
|
|
|
|
|
|
| 00000000 47000008 20100102 00110200 00000000 40000082 02000000 00000001 05200800 00084840 08100000 40128000 00010002 00240000 80000020 00000008 04000200 02000000 02002000 00020201 40000100 08000001 00004300 00f40010 00000000 80020001 00120020 90000000 0000000a 03020022 00020000 01010620 | 08012082 65c03008 20104108 15310600 00241023 00018080 96060080 22081408 00800284 105988c0 08202404 4003b000 0f00c802 00442001 c1420541 025ea00c 02020040 02082004 04282810 00465a01 c0400000 bc248e19 30800103 b3440038 02000000 c0000002 08322048 9020406c 0c404384 00260403 a4067c00 01252670 |