On Target PA_INFA 0.36036035/CHEMBL573638
For the given ligand DB00279, we have found in our database that, being scored 0.36036035, the most similar ligand is CHEMBL573638. Check out the elaboration below.
| DB00279 (Given Ligand) | CHEMBL573638 (Similar Ligand) |
|---|---|
| N[C@H](Cc2cc(I)c(Oc1ccc(O)c(I)c1)c(I)c2)C(=O)O | O=C(O)/C(O)=C/C(=O)c1ccc(Oc2ccccc2)cc1 |
|
|
|
|
|
|
| 00001000 46000008 a0300108 00010600 00001000 00000008 02040000 00000040 00000800 00080840 08100000 4800b000 04008042 02002000 01080001 00080058 00000000 02000000 00402108 00020001 00410140 18002a00 03000040 81400010 00000800 80000000 001a0000 00200000 04000200 00060002 00200400 02000400 | 00000000 00000808 20000109 00010200 00001000 00800000 02040001 00000400 01000000 00980840 08000000 4000c000 80008002 00000000 01000001 00080008 00000400 02100000 00252010 00020800 00400000 18020a80 04008000 00400014 00001000 84004400 00520000 00200000 00004200 00020002 84000400 00000400 |