On Target PA_INFA 0.24630542/CHEMBL278402
For the given ligand DB01061, we have found in our database that, being scored 0.24630542, the most similar ligand is CHEMBL278402. Check out the elaboration below.
| DB01061 (Given Ligand) | CHEMBL278402 (Similar Ligand) |
|---|---|
| CC4(C)S[C@@H]3[C@@H](NC(=O)[C@H](NC(=O)N1CCNC1=O)c2ccccc2)C(=O)N3[C@@H]4C(=O)O | O=C(O)C(=O)/C=C(\O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 00010000 47807000 20164360 0c310e40 00000080 00000000 00201204 02003008 00000080 0a0e4840 0b200003 4004b000 0f01e806 000c2101 c0180001 00480008 14004410 02002200 00400050 00400309 c0020100 38238e00 03000703 87400018 00001200 80000020 00004000 80000000 0c001100 00060023 20046011 83012680 | 00008000 01000000 00900902 00110600 00100000 00000000 000001c0 22001402 15100840 001808c2 08300200 5001d800 82028826 00200000 00000404 00080008 00004000 02000000 00450000 00000201 00000100 18008b80 01008040 00500010 00202000 c0000000 00440000 90000000 04004100 00060002 34040000 00030e00 |