On Target PR_HIV1 0.2457627/CHEMBL492666
For the given ligand DB01061, we have found in our database that, being scored 0.2457627, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| DB01061 (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| CC4(C)S[C@@H]3[C@@H](NC(=O)[C@H](NC(=O)N1CCNC1=O)c2ccccc2)C(=O)N3[C@@H]4C(=O)O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00010000 47807000 20164360 0c310e40 00000080 00000000 00201204 02003008 00000080 0a0e4840 0b200003 4004b000 0f01e806 000c2101 c0180001 00480008 14004410 02002200 00400050 00400309 c0020100 38238e00 03000703 87400018 00001200 80000020 00004000 80000000 0c001100 00060023 20046011 83012680 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |