On Target RT_HIV1 0.28431374/CHEMBL4224769
For the given ligand DB00558, we have found in our database that, being scored 0.28431374, the most similar ligand is CHEMBL4224769. Check out the elaboration below.
| DB00558 (Given Ligand) | CHEMBL4224769 (Similar Ligand) |
|---|---|
| CC(=O)N[C@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@@H]1[C@H](O)[C@@H](O)CO | C=C(C)[C@@H]1CC[C@]2(CNCCN3CCOCC3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 00000000 01000800 00100302 c4050600 00000080 00004000 80000080 20000402 00000900 001808c0 08300000 40018800 00028002 00202000 0010140a 00080108 10000400 02000020 02012000 00000201 01000100 38020a30 12008021 02500014 01200400 80000000 00406000 d0000001 08400202 01060002 e4020000 00000600 |