On Target RT_HIV1 0.25405404/CHEMBL3683703
For the given ligand DB00279, we have found in our database that, being scored 0.25405404, the most similar ligand is CHEMBL3683703. Check out the elaboration below.
| DB00279 (Given Ligand) | CHEMBL3683703 (Similar Ligand) |
|---|---|
| N[C@H](Cc2cc(I)c(Oc1ccc(O)c(I)c1)c(I)c2)C(=O)O | CCCCCN([C@H](CO)CCC(F)(F)CNC(=O)[C@@H](NC(=O)OC)C(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccc(CO)cc1 |
|
|
|
|
|
|
| 00001000 46000008 a0300108 00010600 00001000 00000008 02040000 00000040 00000800 00080840 08100000 4800b000 04008042 02002000 01080001 00080058 00000000 02000000 00402108 00020001 00410140 18002a00 03000040 81400010 00000800 80000000 001a0000 00200000 04000200 00060002 00200400 02000400 | 00000010 09803200 01100100 05b10600 00081088 0001e0c0 00000000 2100000c 00c40b00 804808c0 08302000 6001b000 0c008002 00c02001 80680000 001e0008 10022000 02080000 00402018 00006601 80000100 38340e30 03100001 db700058 02000800 a0000006 00000020 d000002c 0c000680 2606000b e0004000 00012670 |