On Target RT_HIV1 0.33566433/CHEMBL4225441
For the given ligand DB00947, we have found in our database that, being scored 0.33566433, the most similar ligand is CHEMBL4225441. Check out the elaboration below.
| DB00947 (Given Ligand) | CHEMBL4225441 (Similar Ligand) |
|---|---|
| C[C@@]14CCC[C@@H]1[C@H]3[C@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)Cc2cc(O)ccc2[C@H]3CC4 | C=C(C)[C@@H]1CC[C@]2(CN(C)CCCN3CCS(=O)(=O)CC3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000000 47000008 20100102 00110200 00000000 40000082 02000000 00000001 05200800 00084840 08100000 40128000 00010002 00240000 80000020 00000008 04000200 02000000 02002000 00020201 40000100 08000001 00004300 00f40010 00000000 80020001 00120020 90000000 0000000a 03020022 00020000 01010620 | 00000000 45000c00 20100302 48150600 00000000 00004000 80000080 20000402 00020900 021a49e0 08302000 40018800 00028006 00240000 80000402 00080008 04000400 02010020 02012000 00000201 01000100 18020a30 00008260 04580014 01200000 80000000 00406000 d0000000 00400002 01060012 e4020000 02012620 |