On Target NS5B_HCV1A 0.3869565/CHEMBL3644876
For the given ligand DB01061, we have found in our database that, being scored 0.3869565, the most similar ligand is CHEMBL3644876. Check out the elaboration below.
| DB01061 (Given Ligand) | CHEMBL3644876 (Similar Ligand) |
|---|---|
| CC4(C)S[C@@H]3[C@@H](NC(=O)[C@H](NC(=O)N1CCNC1=O)c2ccccc2)C(=O)N3[C@@H]4C(=O)O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(C(=O)Cc2ccccc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00010000 47807000 20164360 0c310e40 00000080 00000000 00201204 02003008 00000080 0a0e4840 0b200003 4004b000 0f01e806 000c2101 c0180001 00480008 14004410 02002200 00400050 00400309 c0020100 38238e00 03000703 87400018 00001200 80000020 00004000 80000000 0c001100 00060023 20046011 83012680 | 00010080 0d403400 00100100 05310f00 00080000 00018000 000a0004 a0003408 10800280 005a89e8 08202400 4001b000 0f00f002 01042101 c0400400 001a8008 02824018 02082001 40610850 00004201 00000100 bc2d0e10 01000003 b3440038 02013000 80001002 00000000 9020002c 0c000200 81060293 a4186000 01012670 |