On Target NS5B_HCV1B 0.19158879/CHEMBL3645194
For the given ligand DB00800, we have found in our database that, being scored 0.19158879, the most similar ligand is CHEMBL3645194. Check out the elaboration below.
| DB00800 (Given Ligand) | CHEMBL3645194 (Similar Ligand) |
|---|---|
| Oc3ccc([C@H]2CNCCc1c(Cl)c(O)c(O)cc12)cc3 | CCN(c1cc2nn(-c3ccc(Cl)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00008000 46000008 20110100 00010600 00000020 80000000 16000400 01000001 00000080 00080844 08200000 40808900 02000006 00200002 80000000 00008008 00000200 02100000 00100000 00020200 00000400 18200100 00004000 814a0010 00002000 a0000a00 00120000 40000000 06000080 00060002 00000000 00022600 | 0000c006 00805e08 20080902 41310e00 010c0000 00004042 02040000 02001408 00100900 000908c0 09312024 40118800 82008c27 01400201 800a0040 000e200c 04268000 02000604 08600008 00224201 c0100101 1c838f38 20800800 8360001c 02106080 c0000040 002f0080 8000108c 0c488104 0046004b c4048080 a01347e0 |