On Target NS5B_HCV1B 0.24311927/CHEMBL3645180
For the given ligand DB00279, we have found in our database that, being scored 0.24311927, the most similar ligand is CHEMBL3645180. Check out the elaboration below.
| DB00279 (Given Ligand) | CHEMBL3645180 (Similar Ligand) |
|---|---|
| N[C@H](Cc2cc(I)c(Oc1ccc(O)c(I)c1)c(I)c2)C(=O)O | CCN(c1cc2nn(-c3ccc(Oc4ccccc4F)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00001000 46000008 a0300108 00010600 00001000 00000008 02040000 00000040 00000800 00080840 08100000 4800b000 04008042 02002000 01080001 00080058 00000000 02000000 00402108 00020001 00410140 18002a00 03000040 81400010 00000800 80000000 001a0000 00200000 04000200 00060002 00200400 02000400 | 00004006 00805e08 2018090a 43310e00 010c1000 00004052 02040000 02001408 00100900 000908c0 09312024 40118800 80008c23 01401201 810a0841 000e200c 04268800 02000004 08602008 00224201 c0500101 3c838e38 20800800 8360001c 02104080 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |