On Target NS5B_HCV1B 0.22421524/CHEMBL3645212
For the given ligand DB00947, we have found in our database that, being scored 0.22421524, the most similar ligand is CHEMBL3645212. Check out the elaboration below.
| DB00947 (Given Ligand) | CHEMBL3645212 (Similar Ligand) |
|---|---|
| C[C@@]14CCC[C@@H]1[C@H]3[C@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)Cc2cc(O)ccc2[C@H]3CC4 | CNC(=O)c1c2cc(C3CC3)c(N(CCCSC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00000000 47000008 20100102 00110200 00000000 40000082 02000000 00000001 05200800 00084840 08100000 40128000 00010002 00240000 80000020 00000008 04000200 02000000 02002000 00020201 40000100 08000001 00004300 00f40010 00000000 80020001 00120020 90000000 0000000a 03020022 00020000 01010620 | 00004006 0080de08 20180902 41310e40 210c0000 00004042 02044000 02001408 00100904 004948c0 09312024 40118800 80118c33 01440201 800a0040 000e200e 04268000 02000004 08600008 00224601 c0100101 1c838e38 2080ca00 9360001c 02104080 c0020040 00270080 8000108c 0c488104 0046006b c4048088 a91147e0 |