On Target NSP15_SARS 0.21030043/CHEMBL2441745
For the given ligand DB00558, we have found in our database that, being scored 0.21030043, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| DB00558 (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| CC(=O)N[C@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@@H]1[C@H](O)[C@@H](O)CO | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |