On Target PLP_SARS 0.23333333/CHEMBL358279
For the given ligand DB00800, we have found in our database that, being scored 0.23333333, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| DB00800 (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| Oc3ccc([C@H]2CNCCc1c(Cl)c(O)c(O)cc12)cc3 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 00008000 46000008 20110100 00010600 00000020 80000000 16000400 01000001 00000080 00080844 08200000 40808900 02000006 00200002 80000000 00008008 00000200 02100000 00100000 00020200 00000400 18200100 00004000 814a0010 00002000 a0000a00 00120000 40000000 06000080 00060002 00000000 00022600 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |