On Target NS3_HCV1A 0.32704404/CHEMBL4108323
For the given ligand DB01196, we have found in our database that, being scored 0.32704404, the most similar ligand is CHEMBL4108323. Check out the elaboration below.
| DB01196 (Given Ligand) | CHEMBL4108323 (Similar Ligand) |
|---|---|
| C[C@@]34CC[C@H]2c1ccc(OC(=O)N(CCCl)CCCl)cc1CC[C@H]2[C@H]3CC[C@H]4O | COc1cc(C(=O)c2c(Cl)ccc([C@H](N)C3CC3)c2F)ccc1C#N |
|
|
|
|
|
|
| 00048000 43000008 6000010a 00010600 00081000 40000202 02040000 00000001 04000a00 00080840 08300000 40008000 00008a02 20a00000 01010021 001a0008 a0020200 02000100 02482000 00020201 00000100 08000d10 11004000 00402018 00000000 88010023 00120000 00000000 00000202 01060003 80020000 10020600 | 00008044 43000808 2010010a 42010600 00001221 00000010 22000000 01001000 00000900 00880ec0 08100000 40808a00 02008866 21201004 01004001 28082008 03400200 03000000 00880400 00020201 00000502 18028300 01000400 10420014 00002000 a0000200 08040000 40800081 00000380 00068422 84040000 00020600 |