Created at: Last updated at: Current status:
|
Name | DB01380 |
2D and 3D depictions | |
SMILES | CC(=O)OCC(=O)[C@]4(O)CC[C@H]3[C@@H]2CC/C1=C/C(=O)CC[C@]1(C)[C@H]2C(=O)C[C@@]34C |
Model downloads | |
Fingerprints |
Name | DB01196 |
2D and 3D depictions | |
SMILES | C[C@@]34CC[C@H]2c1ccc(OC(=O)N(CCCl)CCCl)cc1CC[C@H]2[C@H]3CC[C@H]4O |
Model downloads | |
Fingerprints |
Name | DB09403 |
2D and 3D depictions | |
SMILES | CC(=O)N(C[C@H](C)C(=O)O)c1c(I)cc(I)c(N)c1I |
Model downloads | |
Fingerprints |
Name | DB06796 |
2D and 3D depictions | |
SMILES | Cc2nc(COP(=O)(O)O)cc(CN(CCN(CC(=O)[O-])Cc1cc(COP(=O)(O)O)nc(C)c1O)CC(=O)[O-])c2O |
Model downloads | |
Fingerprints |
Name | DB14650 |
2D and 3D depictions | |
SMILES | Cc2cc(OP(=O)(O)O)c1ccccc1c2OP(=O)(O)O |
Model downloads | |
Fingerprints |