On Target NS3_HCV1A 0.29353234/CHEMBL3645763
For the given ligand DB06796, we have found in our database that, being scored 0.29353234, the most similar ligand is CHEMBL3645763. Check out the elaboration below.
| DB06796 (Given Ligand) | CHEMBL3645763 (Similar Ligand) |
|---|---|
| Cc2nc(COP(=O)(O)O)cc(CN(CCN(CC(=O)[O-])Cc1cc(COP(=O)(O)O)nc(C)c1O)CC(=O)[O-])c2O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1ccnc3ccccc13)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 0000800a 0000080c 66004106 14000608 000400a5 00004004 30804000 00201400 00000300 001100c0 48200004 40002000 82008806 0002a021 00120400 020e300c 10008028 02880000 00200000 40020002 40000000 2c008a20 22800002 02400000 00006400 c0000000 0a420040 80051000 08008104 10060000 4400c080 00008220 | 000180a2 09003800 06104100 05210600 00040000 00000010 000a0000 2200140c 10000000 0011c9c8 00602004 4001b000 8601881a 01402011 a0400440 00040004 04004008 02000000 46212000 00004201 40000000 38068638 20800003 b2d0003c 00004000 c0000000 00000000 90000010 08000100 c0060081 e406c004 00012260 |