On Target ACE2_HUMAN 0.2990654/CHEMBL76
For the given ligand DB09403, we have found in our database that, being scored 0.2990654, the most similar ligand is CHEMBL76. Check out the elaboration below.
| DB09403 (Given Ligand) | CHEMBL76 (Similar Ligand) |
|---|---|
| CC(=O)N(C[C@H](C)C(=O)O)c1c(I)cc(I)c(N)c1I | Clc1cc2nccc(c2cc1)NC(C)CCCN(CC)CC |
|
|
|
|
|
|
| 00005002 00001000 00100000 00000600 28000000 00000000 00000000 00000000 00000001 00000840 00280004 50019000 08008042 02100000 000a0040 00080008 00040000 00000001 08800110 00000204 40110040 18100e00 21002080 00100018 00081001 00100000 00800420 10000080 00808000 00060001 00200000 00000200 | 0001c002 01000000 00104000 00000600 200c0000 00002000 08008000 20000000 00200000 000008c0 00200004 40038800 02000806 00400000 00020040 00040004 00040000 00000000 08200000 00000201 40100000 18048108 20800000 80100010 00006000 00000000 00008000 10000080 00008000 00060000 00040000 00420240 |