On Target ACE2_HUMAN 0.16814159/CHEMBL253224
For the given ligand DB14650, we have found in our database that, being scored 0.16814159, the most similar ligand is CHEMBL253224. Check out the elaboration below.
| DB14650 (Given Ligand) | CHEMBL253224 (Similar Ligand) |
|---|---|
| Cc2cc(OP(=O)(O)O)c1ccccc1c2OP(=O)(O)O | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
|
|
|
|
|
|
| 00200000 40000008 20000100 00010200 00000014 00000000 02024000 00000000 08000000 40000840 00000000 40408000 00000402 40020000 00000000 00002008 00000020 02000000 00100000 00020200 00000000 0c000008 00000000 00400000 00000100 80000000 02080000 00030000 02000000 00020000 00000000 20128000 | 00010000 01005008 20100100 00110600 00000080 00000000 82000000 20000004 00000880 020a08c0 08300000 4001b000 06008002 00040000 80080000 00080008 10000000 02000000 00400008 00020201 00000100 18200e00 03000140 85500018 00000800 80000000 00120000 10000040 04000000 00060003 20004000 03012600 |