On Target RT_HIV1 0.27807486/CHEMBL4227326
For the given ligand DB06796, we have found in our database that, being scored 0.27807486, the most similar ligand is CHEMBL4227326. Check out the elaboration below.
| DB06796 (Given Ligand) | CHEMBL4227326 (Similar Ligand) |
|---|---|
| Cc2nc(COP(=O)(O)O)cc(CN(CCN(CC(=O)[O-])Cc1cc(COP(=O)(O)O)nc(C)c1O)CC(=O)[O-])c2O | C=C(C)[C@@H]1CC[C@]2(CNCCc3ccccn3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 0000800a 0000080c 66004106 14000608 000400a5 00004004 30804000 00201400 00000300 001100c0 48200004 40002000 82008806 0002a021 00120400 020e300c 10008028 02880000 00200000 40020002 40000000 2c008a20 22800002 02400000 00006400 c0000000 0a420040 80051000 08008104 10060000 4400c080 00008220 | 0400000a 01000800 00104322 50050600 00040020 00004000 80000080 20000402 00000980 00180ac0 08308004 40818800 00028802 00200000 01020402 020c000c 00000400 0a000020 02212000 00000201 41000100 18228a30 20808020 81500014 01201000 80000000 00406040 d0000000 04400006 01060002 e4020000 20002600 |