On Target NS5B_HCV1A 0.28688523/CHEMBL352277
For the given ligand DB09403, we have found in our database that, being scored 0.28688523, the most similar ligand is CHEMBL352277. Check out the elaboration below.
| DB09403 (Given Ligand) | CHEMBL352277 (Similar Ligand) |
|---|---|
| CC(=O)N(C[C@H](C)C(=O)O)c1c(I)cc(I)c(N)c1I | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 00005002 00001000 00100000 00000600 28000000 00000000 00000000 00000000 00000001 00000840 00280004 50019000 08008042 02100000 000a0040 00080008 00040000 00000001 08800110 00000204 40110040 18100e00 21002080 00100018 00081001 00100000 00800420 10000080 00808000 00060001 00200000 00000200 | 00010000 01403000 00100000 04000600 00081000 00018000 00000000 20000008 04800200 00000080 00200000 4001f000 0e008002 00002001 80000000 001a0408 000a0000 00080001 00c00810 00000201 00000000 30140e10 01000083 02100018 00001001 00000082 00000060 90200020 08000200 02040001 a0004000 00002200 |