On Target NS5B_HCV1B 0.21818182/CHEMBL3645205
For the given ligand DB09403, we have found in our database that, being scored 0.21818182, the most similar ligand is CHEMBL3645205. Check out the elaboration below.
| DB09403 (Given Ligand) | CHEMBL3645205 (Similar Ligand) |
|---|---|
| CC(=O)N(C[C@H](C)C(=O)O)c1c(I)cc(I)c(N)c1I | CNC(=O)c1c2cc(C3CC3)c(N(CCC(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(F)cc1 |
|
|
|
|
|
|
| 00005002 00001000 00100000 00000600 28000000 00000000 00000000 00000000 00000001 00000840 00280004 50019000 08008042 02100000 000a0040 00080008 00040000 00000001 08800110 00000204 40110040 18100e00 21002080 00100018 00081001 00100000 00800420 10000080 00808000 00060001 00200000 00000200 | 00004006 00805e08 20180902 43310e00 210c0000 00004052 22040000 02001408 00100900 004908c0 09312034 50119800 88008c23 01401201 810a0040 000e200e 0426c004 02400004 08e00018 00224205 c0100101 1c838e38 21801880 9360001c 02104080 c0000040 00270080 8000108d 0c488304 0046804b c4048080 a01147e0 |