On Target NS5B_HCV1B 0.24/CHEMBL3645202
For the given ligand DB01196, we have found in our database that, being scored 0.24, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| DB01196 (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| C[C@@]34CC[C@H]2c1ccc(OC(=O)N(CCCl)CCCl)cc1CC[C@H]2[C@H]3CC[C@H]4O | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00048000 43000008 6000010a 00010600 00081000 40000202 02040000 00000001 04000a00 00080840 08300000 40008000 00008a02 20a00000 01010021 001a0008 a0020200 02000100 02482000 00020201 00000100 08000d10 11004000 00402018 00000000 88010023 00120000 00000000 00000202 01060003 80020000 10020600 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |