On Target NA_INFB 0.10828026/CHEMBL79499
For the given ligand DB14650, we have found in our database that, being scored 0.10828026, the most similar ligand is CHEMBL79499. Check out the elaboration below.
| DB14650 (Given Ligand) | CHEMBL79499 (Similar Ligand) |
|---|---|
| Cc2cc(OP(=O)(O)O)c1ccccc1c2OP(=O)(O)O | CC[C@H](CCc1ccccc1)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00200000 40000008 20000100 00010200 00000014 00000000 02024000 00000000 08000000 40000840 00000000 40408000 00000402 40020000 00000000 00002008 00000020 02000000 00100000 00020200 00000000 0c000008 00000000 00400000 00000100 80000000 02080000 00030000 02000000 00020000 00000000 20128000 | 00070040 09007008 00100102 80010700 00180080 00000800 02080180 38000402 11000800 001808c8 48300000 41019001 0402801a 01a80000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000120 38040e80 13008040 02500018 10001400 80001400 00c04000 90000001 0c000202 00060403 04020000 00000610 |