On Target RDRP_SARS2 0.114583336/CHEMBL4065616
For the given ligand DB01380, we have found in our database that, being scored 0.114583336, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| DB01380 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| CC(=O)OCC(=O)[C@]4(O)CC[C@H]3[C@@H]2CC/C1=C/C(=O)CC[C@]1(C)[C@H]2C(=O)C[C@@]34C | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 00050000 01000000 00000100 00010300 00080040 00000000 00000080 00000402 01000000 01128000 00000000 4000d000 04028008 00800000 00000400 00081008 00820000 80000020 03412000 02000001 00000020 00000a80 01008000 00000014 00200400 00000000 00404000 80000000 00000200 8100000a 24020000 02000000 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |