On Target NP_HCoV-OC43 0.12765957/CHEMBL3233481
For the given ligand DB01196, we have found in our database that, being scored 0.12765957, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| DB01196 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| C[C@@]34CC[C@H]2c1ccc(OC(=O)N(CCCl)CCCl)cc1CC[C@H]2[C@H]3CC[C@H]4O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00048000 43000008 6000010a 00010600 00081000 40000202 02040000 00000001 04000a00 00080840 08300000 40008000 00008a02 20a00000 01010021 001a0008 a0020200 02000100 02482000 00020201 00000100 08000d10 11004000 00402018 00000000 88010023 00120000 00000000 00000202 01060003 80020000 10020600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |