On Target NP_HCoV-OC43 0.040983606/CHEMBL3233481
For the given ligand DB01380, we have found in our database that, being scored 0.040983606, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| DB01380 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(=O)OCC(=O)[C@]4(O)CC[C@H]3[C@@H]2CC/C1=C/C(=O)CC[C@]1(C)[C@H]2C(=O)C[C@@]34C | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00050000 01000000 00000100 00010300 00080040 00000000 00000080 00000402 01000000 01128000 00000000 4000d000 04028008 00800000 00000400 00081008 00820000 80000020 03412000 02000001 00000020 00000a80 01008000 00000014 00200400 00000000 00404000 80000000 00000200 8100000a 24020000 02000000 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |