On Target NP_HCoV-OC43 0.1/CHEMBL3233481
For the given ligand DB14650, we have found in our database that, being scored 0.1, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| DB14650 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Cc2cc(OP(=O)(O)O)c1ccccc1c2OP(=O)(O)O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00200000 40000008 20000100 00010200 00000014 00000000 02024000 00000000 08000000 40000840 00000000 40408000 00000402 40020000 00000000 00002008 00000020 02000000 00100000 00020200 00000000 0c000008 00000000 00400000 00000100 80000000 02080000 00030000 02000000 00020000 00000000 20128000 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |