On Target PLP_SARS 0.28368795/CHEMBL358279
For the given ligand DB09403, we have found in our database that, being scored 0.28368795, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| DB09403 (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| CC(=O)N(C[C@H](C)C(=O)O)c1c(I)cc(I)c(N)c1I | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 00005002 00001000 00100000 00000600 28000000 00000000 00000000 00000000 00000001 00000840 00280004 50019000 08008042 02100000 000a0040 00080008 00040000 00000001 08800110 00000204 40110040 18100e00 21002080 00100018 00081001 00100000 00800420 10000080 00808000 00060001 00200000 00000200 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |