On Target PLP_SARS 0.25827813/CHEMBL222735
For the given ligand DB01196, we have found in our database that, being scored 0.25827813, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| DB01196 (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| C[C@@]34CC[C@H]2c1ccc(OC(=O)N(CCCl)CCCl)cc1CC[C@H]2[C@H]3CC[C@H]4O | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 00048000 43000008 6000010a 00010600 00081000 40000202 02040000 00000001 04000a00 00080840 08300000 40008000 00008a02 20a00000 01010021 001a0008 a0020200 02000100 02482000 00020201 00000100 08000d10 11004000 00402018 00000000 88010023 00120000 00000000 00000202 01060003 80020000 10020600 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |