On Target PLP_SARS 0.175/CHEMBL222735
For the given ligand DB14650, we have found in our database that, being scored 0.175, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| DB14650 (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| Cc2cc(OP(=O)(O)O)c1ccccc1c2OP(=O)(O)O | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 00200000 40000008 20000100 00010200 00000014 00000000 02024000 00000000 08000000 40000840 00000000 40408000 00000402 40020000 00000000 00002008 00000020 02000000 00100000 00020200 00000000 0c000008 00000000 00400000 00000100 80000000 02080000 00030000 02000000 00020000 00000000 20128000 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |