On Target NS3_HCV1A 0.23275863/CHEMBL296588
For the given ligand DB00838, we have found in our database that, being scored 0.23275863, the most similar ligand is CHEMBL296588. Check out the elaboration below.
| DB00838 (Given Ligand) | CHEMBL296588 (Similar Ligand) |
|---|---|
| C[C@H]4C[C@H]3[C@H]2C[C@@H](F)/C1=C/C(=O)/C=C\[C@@]1(C)[C@]2(Cl)[C@@H](O)C[C@]3(C)[C@H]4C(=O)CO | CC(C)CC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)[C@@H](O)CC(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)[C@@H](O)CC(=O)O)C(C)C)C(C)C |
|
|
|
|
|
|
| 000b0002 81000000 00100000 00080000 00981400 00000000 00000080 02000402 01000000 00100000 00000401 40005000 04028028 00800000 00000400 08080008 00000000 00002000 02412000 00022001 00000001 80000380 01008000 00100810 00200000 08000020 00404020 b0000008 00800000 03000000 24020000 00820a00 | 00030000 01007000 00100000 04000400 00180080 00000000 00000000 20000008 00200000 00000080 00200000 40033000 1600800a 00802001 80180000 00080008 10000000 00000000 01c02000 00000201 00000000 30040e10 03000083 02100018 00000001 00000000 00000000 10000000 08000000 00040001 20024000 00802a00 |