Created at: Last updated at: Current status:
|
Name | DB00374 |
2D and 3D depictions | |
SMILES | CCCCC[C@@H](O)CC[C@@H]3[C@@H](O)C[C@H]2Cc1c(cccc1OCC(=O)O)C[C@H]23 |
Model downloads | |
Fingerprints |
Name | DB00984 |
2D and 3D depictions | |
SMILES | C[C@@]34CC[C@H]2[C@H]1CCC(=O)/C=C1/CC[C@@H]2[C@@H]3CC[C@@H]4OC(=O)CCc5ccccc5 |
Model downloads | |
Fingerprints |
Name | DB00663 |
2D and 3D depictions | |
SMILES | C[C@@H]4C[C@@H]3[C@@H]2C[C@@H](F)/C1=C/C(=O)/C=C\[C@@]1(C)[C@]2(F)[C@@H](O)C[C@]3(C)[C@]4(O)C(=O)CO |
Model downloads | |
Fingerprints |
Name | DB00838 |
2D and 3D depictions | |
SMILES | C[C@H]4C[C@H]3[C@H]2C[C@@H](F)/C1=C/C(=O)/C=C\[C@@]1(C)[C@]2(Cl)[C@@H](O)C[C@]3(C)[C@H]4C(=O)CO |
Model downloads | |
Fingerprints |
Name | DB00223 |
2D and 3D depictions | |
SMILES | C[C@H]4C[C@H]3[C@H]2C[C@@H](F)/C1=C/C(=O)/C=C\[C@@]1(C)[C@]2(F)[C@@H](O)C[C@]3(C)[C@]4(O)C(=O)CO |
Model downloads | |
Fingerprints |