On Target NS3_HCV1B 0.24427481/CHEMBL3927196
For the given ligand DB00223, we have found in our database that, being scored 0.24427481, the most similar ligand is CHEMBL3927196. Check out the elaboration below.
| DB00223 (Given Ligand) | CHEMBL3927196 (Similar Ligand) |
|---|---|
| C[C@H]4C[C@H]3[C@H]2C[C@@H](F)/C1=C/C(=O)/C=C\[C@@]1(C)[C@]2(F)[C@@H](O)C[C@]3(C)[C@]4(O)C(=O)CO | CC(C)=CC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC2[C@@H]([C@H]1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C2(C)C |
|
|
|
|
|
|
| 00010002 81400000 00100000 00081000 00281400 00000000 00000080 02000402 01000000 00100000 00000001 40005000 04028028 00800000 00000400 08080008 00000000 00000000 03412000 00022001 00000001 00000280 01008000 00520810 00200000 00000022 00404020 b0000000 00000000 13000000 24020000 00000200 | 00030000 01403400 00100000 04000600 00000000 00018010 00000000 20000408 05800200 00120180 00200000 5001b000 0e02801a 01002011 80000400 001a0008 00020000 00080001 00012810 00000201 00000000 300c0e70 00008003 02100018 00001000 00000002 00404000 90200020 08000200 00040011 a4024000 00802200 |