On Target PA_INFA 0.27272728/CHEMBL2040554
For the given ligand DB00663, we have found in our database that, being scored 0.27272728, the most similar ligand is CHEMBL2040554. Check out the elaboration below.
| DB00663 (Given Ligand) | CHEMBL2040554 (Similar Ligand) |
|---|---|
| C[C@@H]4C[C@@H]3[C@@H]2C[C@@H](F)/C1=C/C(=O)/C=C\[C@@]1(C)[C@]2(F)[C@@H](O)C[C@]3(C)[C@]4(O)C(=O)CO | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(CC2CCCCC2)CC1 |
|
|
|
|
|
|
| 00010002 81400000 00100000 00081000 00281400 00000000 00000080 02000402 01000000 00100000 00000001 40005000 04028028 00800000 00000400 08080008 00000000 00000000 03412000 00022001 00000001 00000280 01008000 00520810 00200000 00000022 00404020 b0000000 00000000 13000000 24020000 00000200 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 28000400 01100800 001808c0 08300000 5001d800 86028026 00200000 00000400 00080008 00000000 02000000 02252018 00000201 00000100 18000b90 04008000 00500010 00003800 80002400 00444000 90000000 00004000 00060002 04020000 00822600 |