On Target GP_EBOV 0.33766234/CHEMBL112570
For the given ligand DB00838, we have found in our database that, being scored 0.33766234, the most similar ligand is CHEMBL112570. Check out the elaboration below.
| DB00838 (Given Ligand) | CHEMBL112570 (Similar Ligand) |
|---|---|
| C[C@H]4C[C@H]3[C@H]2C[C@@H](F)/C1=C/C(=O)/C=C\[C@@]1(C)[C@]2(Cl)[C@@H](O)C[C@]3(C)[C@H]4C(=O)CO | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 000b0002 81000000 00100000 00080000 00981400 00000000 00000080 02000402 01000000 00100000 00000401 40005000 04028028 00800000 00000400 08080008 00000000 00002000 02412000 00022001 00000001 80000380 01008000 00100810 00200000 08000020 00404020 b0000008 00800000 03000000 24020000 00820a00 | 00000000 01000000 00000800 00000000 00080000 00000000 00000000 00000402 00000000 00100008 00000200 40000000 00020000 00800000 00000404 00080008 00000000 00000020 02402000 00000001 00000000 00000000 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000000 24020000 00000000 |