On Target GP_EBOV 0.36619717/CHEMBL112570
For the given ligand DB00663, we have found in our database that, being scored 0.36619717, the most similar ligand is CHEMBL112570. Check out the elaboration below.
| DB00663 (Given Ligand) | CHEMBL112570 (Similar Ligand) |
|---|---|
| C[C@@H]4C[C@@H]3[C@@H]2C[C@@H](F)/C1=C/C(=O)/C=C\[C@@]1(C)[C@]2(F)[C@@H](O)C[C@]3(C)[C@]4(O)C(=O)CO | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00010002 81400000 00100000 00081000 00281400 00000000 00000080 02000402 01000000 00100000 00000001 40005000 04028028 00800000 00000400 08080008 00000000 00000000 03412000 00022001 00000001 00000280 01008000 00520810 00200000 00000022 00404020 b0000000 00000000 13000000 24020000 00000200 | 00000000 01000000 00000800 00000000 00080000 00000000 00000000 00000402 00000000 00100008 00000200 40000000 00020000 00800000 00000404 00080008 00000000 00000020 02402000 00000001 00000000 00000000 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000000 24020000 00000000 |