On Target PR_HIV1 0.23728813/CHEMBL494500
For the given ligand DB00984, we have found in our database that, being scored 0.23728813, the most similar ligand is CHEMBL494500. Check out the elaboration below.
| DB00984 (Given Ligand) | CHEMBL494500 (Similar Ligand) |
|---|---|
| C[C@@]34CC[C@H]2[C@H]1CCC(=O)/C=C1/CC[C@@H]2[C@@H]3CC[C@@H]4OC(=O)CCc5ccccc5 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCCOCC2)cc1 |
|
|
|
|
|
|
| 00010040 01000008 00000100 00010300 00080000 00000000 00000080 00000402 01000800 00188840 08100000 40009000 04028008 00800000 00000400 00081008 00820000 02000020 02412008 00000001 00000120 08000a80 01008040 00400010 00200c00 80000000 00404000 80000000 00000200 01020002 24020000 00000400 | 00000050 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000004 00540a00 014809e0 08342000 60018000 00008002 00a00101 81e80001 001a1008 10822000 02080000 11402800 01027603 80000120 18280c90 03100040 d9500058 02000400 8000100e 00800000 1020008c 04000600 2006001b 80000000 00012670 |