On Target PR_HIV1 0.13114753/CHEMBL492666
For the given ligand DB00663, we have found in our database that, being scored 0.13114753, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| DB00663 (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| C[C@@H]4C[C@@H]3[C@@H]2C[C@@H](F)/C1=C/C(=O)/C=C\[C@@]1(C)[C@]2(F)[C@@H](O)C[C@]3(C)[C@]4(O)C(=O)CO | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00010002 81400000 00100000 00081000 00281400 00000000 00000080 02000402 01000000 00100000 00000001 40005000 04028028 00800000 00000400 08080008 00000000 00000000 03412000 00022001 00000001 00000280 01008000 00520810 00200000 00000022 00404020 b0000000 00000000 13000000 24020000 00000200 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |