On Target RT_HIV1 0.5744681/CHEMBL3775172
For the given ligand DB00984, we have found in our database that, being scored 0.5744681, the most similar ligand is CHEMBL3775172. Check out the elaboration below.
| DB00984 (Given Ligand) | CHEMBL3775172 (Similar Ligand) |
|---|---|
| C[C@@]34CC[C@H]2[C@H]1CCC(=O)/C=C1/CC[C@@H]2[C@@H]3CC[C@@H]4OC(=O)CCc5ccccc5 | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00010040 01000008 00000100 00010300 00080000 00000000 00000080 00000402 01000800 00188840 08100000 40009000 04028008 00800000 00000400 00081008 00820000 02000020 02412008 00000001 00000120 08000a80 01008040 00400010 00200c00 80000000 00404000 80000000 00000200 01020002 24020000 00000400 | 00010000 01000800 00000302 40050200 00080000 00004000 80000080 00000402 00000900 00188848 08100000 40009800 04028008 00a00000 00000402 00080008 00000400 02000020 02402000 00000001 01000100 08020a20 01008020 00400014 01200000 80000000 00406000 c0000000 00400002 01020002 e4020000 00000400 |